1,3,5-trinitrobenzene


TNB; sym-trinitrobenzene; 1,3,5-trinitrobenzene
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS:[99-35-4]
Formula:C6H3N3O6; 213.11 g/mol
InChiKey:UATJOMSPNYCXIX-UHFFFAOYSA-N
SMILES:[O-][N+](=O)c1cc(cc(c1)[N+]([O-])=O)[N+]([O-])=O
Molecular structure of 1,3,5-trinitrobenzene
Density:1.760 g/mL
Molar volume:121.1 mL/mol
Dipole moment:0.00 D
Melting point:123 °C
Boiling point:315 °C
Log10 partition octanol / water:1.18
1g dissolves in:
16.13g benzene;    16.39g trichloromethane;    20.41g methanol;    52.63g ethanol;    66.67g diethyl ether;    400.00g carbon disulfide

Isomers

1,2,3-trinitrobenzene
Molecular structure of 1,2,3-trinitrobenzene
1,2,4-trinitrobenzene
Molecular structure of 1,2,4-trinitrobenzene
1,3,5-trinitrobenzene
Molecular structure of 1,3,5-trinitrobenzene