2,3,4,5-tetraiodopyrrole


iodol; tetraiodopyrrol; 2,3,4,5-tetraiodopyrrole; 2,3,4,5-tetraiodo-1H-pyrrole
CAS:[87-58-1]
Formula:C4HI4N; 570.67 g/mol
InChiKey:VJOVAKSZILJDBB-UHFFFAOYSA-N
SMILES:Ic1[nH]c(I)c(I)c1I
Molecular structure of 2,3,4,5-tetraiodopyrrole
Dipole moment:2.52 D
1g dissolves in:
1.50g diethyl ether;    9.01g ethanol;    105.26g trichloromethane;    4,901.96g water