2-(2-hydroxyethyl-(1-phenylethyl)amino)ethanol


2-(2-hydroxyethyl-(1-phenylethyl)amino)ethanol; α-methylbenzyldiethanolamine
Formula:C12H19NO2; 209.29 g/mol
InChiKey:PRHRISUFQISTKU-UHFFFAOYSA-N
SMILES:CC(N(CCO)CCO)c1ccccc1
Molecular structure of 2-(2-hydroxyethyl-(1-phenylethyl)amino)ethanol
Miscible with:
(+-)-3-chloro-1,2-propanediol,    (R,S)-2,3-butanediol,    1,2,3-propanetriol,    1,2-diacetoxyethane,    1,2-propanediol,    1,3-propanediol,    2-(2-butoxyethoxy)ethanol,    2-(2-ethoxyethoxy)ethanol,    2-(2-methoxyethoxy)ethanol,    2-butoxyethanol,    2-chloroethanol,    2-ethoxyethanol,    2-methoxyethanol,    2-phenoxyethanol,    3,6,9-trioxaundecane,    3-chloropropanol,    4-oxa-2,6-heptandiol,    dibutyl hydrogen phosphite,    diethylene glycol dibutyl ether,    ethanediol,    triethyl phosphate,    triethylene glycol

Isomers

bamethan
Molecular structure of bamethan
tert-butyl 3,4,5-trimethyl-2-pyrrolecarboxylate
Molecular structure of tert-butyl 3,4,5-trimethyl-2-pyrrolecarboxylate
N-(2,2-diethoxyethyl)aniline
Molecular structure of N-(2,2-diethoxyethyl)aniline
2,5-dimethoxy-4-methylamphetamine
Molecular structure of 2,5-dimethoxy-4-methylamphetamine
ethyl 2-cyano-3,3-dipropylacrylate
Molecular structure of ethyl 2-cyano-3,3-dipropylacrylate
fepradinol
Molecular structure of fepradinol
2-(2-hydroxyethyl-(1-phenylethyl)amino)ethanol
Molecular structure of 2-(2-hydroxyethyl-(1-phenylethyl)amino)ethanol
3-morpholino-5,5-dimethyl-2-cyclohexen-1-one
Molecular structure of 3-morpholino-5,5-dimethyl-2-cyclohexen-1-one
octyl 2-cyanoprop-2-enoate
Molecular structure of octyl 2-cyanoprop-2-enoate
2-(4,7,7-trimethyl-3-oxobicyclo[2.2.1]hept-2-yl)acetamide
Molecular structure of 2-(4,7,7-trimethyl-3-oxobicyclo[2.2.1]hept-2-yl)acetamide