(R,S)-2,3-butanediol


(R,S)-2,3-butanediol; meso-2,3-butanediol; (2R,3~S)-butane-2,3-diol; (R,~S)-butane-2,3-diol
Links:📖 PubMed
CAS:[5341-95-7]
Formula:C4H10O2; 90.12 g/mol
InChiKey:OWBTYPJTUOEWEK-ZXZARUISSA-N
SMILES:C[C@@H](O)[C@H](C)O
Molecular structure of (R,S)-2,3-butanediol
Melting point:35 °C
Boiling point:184 °C
Log10 partition octanol / water:-0.92
Immiscible with:
2,6,8-trimethyl-4-nonanone,    N,N-dipropylaniline,    dihexyl ether
Miscible with:
(E)-3-phenyl-2-propenal,    1-amino-2-propanol,    1-phenylethan-1-amine,    1-tetradecanol,    2,6-dimethyl-4-heptanone,    2-(1-phenylethylamino)ethanol,    2-(2-hydroxyethyl-(1-phenylethyl)amino)ethanol,    2-ethoxyaniline,    2-ethylbutanoic acid,    2-methylphenol,    2-phenylethylamine,    3-heptanol,    3-methyl-2-butanone,    3-methylbutyl acetate,    4-methoxybenzaldehyde,    4-methylpentanoic acid,    5-ethyl-2-methylpyridine,    N,N-diethylformamide,    N-(2-aminoethyl)ethane-1,2-diamine,    a-methylbenzyldimethylamine,    dibutylamine,    diethyl ether,    diisopropylamine,    dipentylamine,    ethanol,    ethyl chloroacetate,    ethyl phenylacetate,    heptyl acetate,    hexanenitrile,    pyridine,    salicylaldehyde,    trans-ethyl cinnamate,    tributyl phosphate,    trichloromethane,    triethylenetetramine

Isomers

1,2-butanediol
Molecular structure of 1,2-butanediol
(±)-1,3-butanediol
Molecular structure of (+-)-1,3-butanediol
(R)-(-)-1,3-butanediol
Molecular structure of (R)-(-)-1,3-butanediol
1,3-butanediol
Molecular structure of 1,3-butanediol
1,4-butanediol
Molecular structure of 1,4-butanediol
(2S,3S)-butane-2,3-diol
Molecular structure of (2S,3S)-butane-2,3-diol
(R,R)-2,3-butanediol
Molecular structure of (R,R)-2,3-butanediol
(R,S)-2,3-butanediol
Molecular structure of (R,S)-2,3-butanediol
dl-2,3-butanediol
Molecular structure of dl-2,3-butanediol
tert-butylhydroperoxide
Molecular structure of tert-butylhydroperoxide
diethyl peroxide
Molecular structure of diethyl peroxide
1,1-dimethoxyethane
Molecular structure of 1,1-dimethoxyethane
1,2-dimethoxyethane
Molecular structure of 1,2-dimethoxyethane
2-ethoxyethanol
Molecular structure of 2-ethoxyethanol
(R)-(-)-1-methoxy-2-propanol
Molecular structure of (R)-(-)-1-methoxy-2-propanol
1-methoxy-2-propanol
Molecular structure of 1-methoxy-2-propanol
2-methoxypropan-1-ol
Molecular structure of 2-methoxypropan-1-ol
3-methoxy-1-propanol
Molecular structure of 3-methoxy-1-propanol
2-methyl-1,2-propanediol
Molecular structure of 2-methyl-1,2-propanediol
2-methyl-1,3-propanediol
Molecular structure of 2-methyl-1,3-propanediol