4-chlorobenzoic acid


4-chlorobenzoic acid, p-chlorobenzoic acid
Links:⚗️ ChemSynthesis, 📖 PubMed
CAS:[74-11-3]
Formula:C7H5ClO2; 156.57 g/mol
InChiKey:XRHGYUZYPHTUJZ-UHFFFAOYSA-N
SMILES:OC(=O)c1ccc(Cl)cc1
Molecular structure of 4-chlorobenzoic acid
Density:1.540 g/mL
Molar volume:101.7 mL/mol
Dipole moment:2.02 D
Melting point:243 °C
Log10 partition octanol / water:3.31
1g dissolvs in:
30.03g 2-propanone;    40.82g diethyl ether;    54.35g ethyl acetate;    3,333.33g tetrachloromethane;    5,000.00g benzene;    10,000.00g carbon disulfide;    10,752.69g water

Isomers

2-chloro-3-hydroxybenzaldehyde
Molecular structure of 2-chloro-3-hydroxybenzaldehyde
2-chloro-4-hydroxybenzaldehyde
Molecular structure of 2-chloro-4-hydroxybenzaldehyde
2-chloro-6-hydroxybenzaldehyde
Molecular structure of 2-chloro-6-hydroxybenzaldehyde
2-chlorobenzoic acid
Molecular structure of 2-chlorobenzoic acid
2-hydroxybenzoyl chloride
Molecular structure of 2-hydroxybenzoyl chloride
3-chloro-2-hydroxybenzaldehyde
Molecular structure of 3-chloro-2-hydroxybenzaldehyde
3-chloro-4-hydroxybenzaldehyde
Molecular structure of 3-chloro-4-hydroxybenzaldehyde
3-chlorobenzoic acid
Molecular structure of 3-chlorobenzoic acid
4-chloro-2-hydroxybenzaldehyde
Molecular structure of 4-chloro-2-hydroxybenzaldehyde
4-chlorobenzoic acid
Molecular structure of 4-chlorobenzoic acid
5-chloro-1,3-benzodioxole
Molecular structure of 5-chloro-1,3-benzodioxole
5-chloro-2-hydroxybenzaldehyde
Molecular structure of 5-chloro-2-hydroxybenzaldehyde
phenyl chloroformate
Molecular structure of phenyl chloroformate