acenaphthene


1,2-dihydroacenaphthylene, 1,8-ethylenenaphthalene, acenaphthene, naphthyleneethylene, peri-ethylenenaphthalene, tricyclo[6.3.1.04,12]dodecapentaene
Links:🌍 Wikipedia, 📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS:[83-32-9]
Formula:C12H10; 154.21 g/mol
InChiKey:CWRYPZZKDGJXCA-UHFFFAOYSA-N
SMILES:c2cc1cccc3c1c(c2)CC3
Molecular structure of acenaphthene
Density:1.024 g/mL
Molar volume:150.6 mL/mol
Refractive index:1.605
Molecular refractive power:51.84 mL/mol
Dielectric constant:3.00
Dipole moment:0.93 D
Melting point:94 °C
Boiling point:277 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Critical pressure:3.1 atm
Log10 partition octanol / water:3.92
1g dissolvs in:
3.70g trichloromethane;    4.08g toluene;    25.00g ethanol;    29.41g propanol;    44.44g methanol

Isomers

1-ethenylnaphthalene
Molecular structure of 1-ethenylnaphthalene
2-vinylnaphthalene
Molecular structure of 2-vinylnaphthalene
acenaphthene
Molecular structure of acenaphthene
biphenyl
Molecular structure of biphenyl
heptalene
Molecular structure of heptalene