apomorphine hydrochloride


apomorphine hydrochloride
Links:🕷 ChemSpider, 📖 PubMed
CAS:[41372-20-7]
Formula:C17H18ClNO2; 303.79 g/mol
InChiKey:SKYZYDSNJIOXRL-BTQNPOSSSA-N
SMILES:[Cl-].CN1CCc2cccc3c2[C@H]1Cc4ccc(O)c(O)c34.[H+]
Molecular structure of apomorphine hydrochloride
Melting point:286 °C
1g dissolves in:
38.17g ethanol;    39.53g water;    1,886.79g diethyl ether;    3,846.15g trichloromethane