azobenzene


(E)-diphenyldiazene, azobenzene, di(phenyl)diazene, diphenyldiazene, trans-azobenzene
Links:🌍 Wikipedia
CAS:[17082-12-1]
Formula:C12H10N2; 182.22 g/mol
InChiKey:DMLAVOWQYNRWNQ-UHFFFAOYSA-N
SMILES:c1ccc(cc1)N=Nc2ccccc2
Molecular structure of azobenzene
Density:1.090 g/mL
Molar volume:167.2 mL/mol
Dipole moment:0.52 D
Melting point:67 °C
Boiling point:293 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Log10 partition octanol / water:3.82
1g dissolvs in:
1.31g pyridine;    16.61g propanol;    17.01g ethanol;    25.32g methanol;    3,333.33g water

Isomers

(2E)-2-benzyl-3-methyl-2-butenedinitrile
Molecular structure of (2E)-2-benzyl-3-methyl-2-butenedinitrile
(2Z)-2-benzyl-3-methyl-2-butenedinitrile
Molecular structure of (2Z)-2-benzyl-3-methyl-2-butenedinitrile
1,2-bis(2-pyridyl)ethylene
Molecular structure of 1,2-bis(2-pyridyl)ethylene
1,2-di(4-pyridyl)ethylene
Molecular structure of 1,2-di(4-pyridyl)ethylene
1-aminocarbazole
Molecular structure of 1-aminocarbazole
2-aminocarbazole
Molecular structure of 2-aminocarbazole
3-aminocarbazole
Molecular structure of 3-aminocarbazole
3-[(E)-2-phenylethenyl]pyridazine
Molecular structure of 3-[(E)-2-phenylethenyl]pyridazine
azobenzene
Molecular structure of azobenzene
cis-azobenzene
Molecular structure of cis-azobenzene