colchicine


colchicine
Links:🌍 Wikipedia, 📏 NIST, 📖 PubMed
MeSH:Gout Suppressants; Mitosis Modulators; Tubulin Modulators
CAS:[64-86-8]
Formula:C22H25NO6; 399.44 g/mol
InChiKey:IAKHMKGGTNLKSZ-INIZCTEOSA-N
SMILES:COC1=CC=C2C(=CC1=O)[C@H](CCc3cc(OC)c(OC)c(OC)c23)NC(C)=O
Molecular structure of colchicine
Melting point:156 °C
Log10 partition octanol / water:1.30
1g dissolvs in:
10.42g water;    74.63g ethyl acetate;    106.38g benzene;    769.23g diethyl ether;    833.33g tetrachloromethane;    1,666.67g hexane

Isomers

benzyl-2-acetamido-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside
Molecular structure of benzyl-2-acetamido-4,6-O-benzylidene-2-deoxy-a-D-glucopyranoside
colchicine
Molecular structure of colchicine