diphenylamine


diphenylamine, N-phenylaniline
Links:🌍 Wikipedia, 📏 NIST, 📖 PubMed
CAS:[122-39-4]
Formula:C12H11N; 169.23 g/mol
InChiKey:DMBHHRLKUKUOEG-UHFFFAOYSA-N
SMILES:N(c1ccccc1)c2ccccc2
Molecular structure of diphenylamine
Density:1.160 g/mL
Molar volume:145.9 mL/mol
Dielectric constant:3.30
Dipole moment:1.30 D
Melting point:54 °C
Boiling point:302 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Log10 partition octanol / water:3.50
1g dissolvs in:
0.33g pyridine;    1.64g carbon disulfide;    1.74g methanol;    1.79g ethanol;    3.40g propanol;    14.93g hexane;    3,333.33g water

Isomers

2,3-dihydro-1H-benz[de]isoquinoline
Molecular structure of 2,3-dihydro-1H-benz[de]isoquinoline
2-(2-methylphenyl)pyridine
Molecular structure of 2-(2-methylphenyl)pyridine
2-(3-methylphenyl)pyridine
Molecular structure of 2-(3-methylphenyl)pyridine
2-(4-methylphenyl)pyridine
Molecular structure of 2-(4-methylphenyl)pyridine
2-aminobiphenyl
Molecular structure of 2-aminobiphenyl
2-benzylpyridine
Molecular structure of 2-benzylpyridine
3-aminobiphenyl
Molecular structure of 3-aminobiphenyl
3-benzylpyridine
Molecular structure of 3-benzylpyridine
4-aminobiphenyl
Molecular structure of 4-aminobiphenyl
4-benzylpyridine
Molecular structure of 4-benzylpyridine
diphenylamine
Molecular structure of diphenylamine