hexamethylenetetramine


hexamethylenetetramine; methenamine; urotropin
Links:🌍 Wikipedia, 📏 NIST, 📖 PubMed
MeSH:Anti-Infective Agents; Anti-Infective Agents, Urinary; Renal Agents
CAS:[100-97-0]
Formula:C6H12N4; 140.19 g/mol
InChiKey:VKYKSIONXSXAKP-UHFFFAOYSA-N
SMILES:C1N2CN3CN1CN(C2)C3
Molecular structure of hexamethylenetetramine
Density:1.330 g/mL
Molar volume:105.4 mL/mol
Dipole moment:0.00 D
Melting point:280 °C
Critical pressure:3.7 atm
Log10 partition octanol / water:-4.15
1g dissolves in:
1.23g water;    12.36g trichloromethane;    31.06g ethanol