homatropine hydrobromide


homatropine hydrobromide; (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-hydroxy-2-phenylacetate hydrobromide
Links:🕷 ChemSpider
CAS:[51-56-9]
Formula:C16H22BrNO3; 356.26 g/mol
InChiKey:DWSGTFTVBLXELC-UHFFFAOYSA-N
SMILES:[H+].[Br-].CN1C2CCC1CC(C2)OC(=O)C(O)c3ccccc3
Molecular structure of homatropine hydrobromide
Melting point:216 °C
1g dissolves in:
5.71g water;    32.47g ethanol;    625.00g trichloromethane