phenylacetic acid


2-phenylacetic acid, benzeneacetic acid, phenylacetic acid, phenylethanoic acid, tropicamide related compound D
Links:🌍 Wikipedia, 📏 NIST, 🕷 ChemSpider, ⚗️ ChemSynthesis, 📖 PubMed
MeSH:Antimetabolites, Antineoplastic; Antineoplastic Agents; Noxae
CAS:[103-82-2]
Formula:C8H8O2; 136.15 g/mol
InChiKey:WLJVXDMOQOGPHL-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)CC(=O)O
Molecular structure of phenylacetic acid
Density:1.081 g/mL
Molar volume:125.9 mL/mol
Dielectric constant:3.00
Melting point:76 °C
Boiling point:265 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Log10 partition octanol / water:1.41
1g dissolvs in:
0.39g methanol;    0.53g ethanol;    0.66g trichloromethane;    0.75g propanol;    1.23g trichloroethene;    1.26g pentachloroethane;    1.39g methanol;    1.54g ethanol;    1.66g trichloromethane;    1.75g propanol;    2.99g tetrachloromethane;    3.72g tetrachloroethene;    3.99g tetrachloromethane;    59.88g water;    60.98g water

Isomers

(E)-4-furan-2-ylbut-3-en-2-one
Molecular structure of (E)-4-furan-2-ylbut-3-en-2-one
2,3-dihydro-1,4-benzodioxine
Molecular structure of 2,3-dihydro-1,4-benzodioxine
2,3-dimethyl-2,5-cyclohexadiene-1,4-dione
Molecular structure of 2,3-dimethyl-2,5-cyclohexadiene-1,4-dione
2,5-dimethyl-1,4-benzoquinone
Molecular structure of 2,5-dimethyl-1,4-benzoquinone
2,6-dimethyl-p-benzoquinone
Molecular structure of 2,6-dimethyl-p-benzoquinone
2-acetylphenol
Molecular structure of 2-acetylphenol
2-anisaldehyde
Molecular structure of 2-anisaldehyde
2-ethylbenzo-1,4-quinone
Molecular structure of 2-ethylbenzo-1,4-quinone
2-hydroxy-1-phenylethanone
Molecular structure of 2-hydroxy-1-phenylethanone
2-hydroxy-3-methylbenzaldehyde
Molecular structure of 2-hydroxy-3-methylbenzaldehyde
2-hydroxy-4-methylbenzaldehyde
Molecular structure of 2-hydroxy-4-methylbenzaldehyde
2-hydroxy-5-methylbenzaldehyde
Molecular structure of 2-hydroxy-5-methylbenzaldehyde
2-hydroxy-6-methylbenzaldehyde
Molecular structure of 2-hydroxy-6-methylbenzaldehyde
2-methylbenzoic acid
Molecular structure of 2-methylbenzoic acid
3,4-(methylenedioxy)toluene
Molecular structure of 3,4-(methylenedioxy)toluene
3-acetylphenol
Molecular structure of 3-acetylphenol
3-anisaldehyde
Molecular structure of 3-anisaldehyde
3-methylbenzoic acid
Molecular structure of 3-methylbenzoic acid
4-(hydroxymethyl)benzaldehyde
Molecular structure of 4-(hydroxymethyl)benzaldehyde
4-hydroxy-2-methylbenzaldehyde
Molecular structure of 4-hydroxy-2-methylbenzaldehyde
4-hydroxy-3-methylbenzaldehyde
Molecular structure of 4-hydroxy-3-methylbenzaldehyde
4-hydroxyacetophenone
Molecular structure of 4-hydroxyacetophenone
4-methoxybenzaldehyde
Molecular structure of 4-methoxybenzaldehyde
4-methylbenzoic acid
Molecular structure of 4-methylbenzoic acid
6,7-dihydro-4(5H)-benzofuranone
Molecular structure of 6,7-dihydro-4(5H)-benzofuranone
benzyl formate
Molecular structure of benzyl formate
bicyclo[4.2.0]oct-3-ene-2,5-dione
Molecular structure of bicyclo[4.2.0]oct-3-ene-2,5-dione
methoxycarbonylbenzene
Molecular structure of methoxycarbonylbenzene
methyl benzoate
Molecular structure of methyl benzoate
phenyl acetate
Molecular structure of phenyl acetate
phenylacetic acid
Molecular structure of phenylacetic acid