piperine


(2E,4E)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one, 1-piperoyl-(E,E)-piperidine, piperine
Links:🌍 Wikipedia, 📏 NIST, 🕷 ChemSpider, 📖 PubMed
MeSH:Cytochrome P-450 Enzyme Inhibitors; Enzyme Inhibitors
CAS:[94-62-2]
Formula:C17H19NO3; 285.34 g/mol
InChiKey:MXXWOMGUGJBKIW-YPCIICBESA-N
SMILES:O=C(/C=C/C=C/c1ccc2OCOc2c1)N3CCCCC3
Molecular structure of piperine
Density:1.193 g/mL
Molar volume:239.2 mL/mol
Melting point:130 °C
1g dissolvs in:
4.45g pyridine;    10.17g trichloroethene;    22.73g methanol;    34.01g propanol;    34.48g ethanol;    10,000.00g water

Isomers

(R)-(+)-2-(carbobenzyloxyamino)-3-phenyl-1-propanol
Molecular structure of (R)-(+)-2-(carbobenzyloxyamino)-3-phenyl-1-propanol
1-(3'-hydroxypropyl)-4,6,8-trimethylfuro[2,3-h]quinolin-2(1H)-one
Molecular structure of 1-(3'-hydroxypropyl)-4,6,8-trimethylfuro[2,3-h]quinolin-2(1H)-one
3-[[(2,6-dimethylphenyl)amino]carbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid
Molecular structure of 3-[[(2,6-dimethylphenyl)amino]carbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid
coclaurine
Molecular structure of coclaurine
hydromorphone
Molecular structure of hydromorphone
morphine
Molecular structure of morphine
N-(2,5-diethoxyphenyl)benzamide
Molecular structure of N-(2,5-diethoxyphenyl)benzamide
norcodeine
Molecular structure of norcodeine
piperine
Molecular structure of piperine
Z-L-phenylalaninol
Molecular structure of Z-L-phenylalaninol