tetra(phenyl)plumbane


tetra(phenyl)plumbane, tetraphenyl lead
Links:📏 NIST, 🕷 ChemSpider
CAS:[595-89-1]
Formula:C24H20Pb; 515.62 g/mol
InChiKey:WBJSMHDYLOJVKC-UHFFFAOYSA-N
SMILES:c1ccc(cc1)[Pb](c2ccccc2)(c3ccccc3)c4ccccc4
Molecular structure of tetra(phenyl)plumbane
1g dissolvs in:
87.34g benzene;    330.03g tetrachloromethane;    813.01g ethyl acetate;    5,000.00g ethanol