tetracyclohexyl lead


tetracyclohexyl lead
Formula:C24H44Pb; 539.81 g/mol
InChiKey:QZSXNPWWIBEWHV-UHFFFAOYSA-N
SMILES:C1CCC(CC1)[Pb](C2CCCCC2)(C3CCCCC3)C4CCCCC4
Molecular structure of tetracyclohexyl lead
1g dissolvs in:
93.63g benzene;    409.84g tetrachloromethane;    3,333.33g ethyl acetate;    10,000.00g ethanol