(R,R)-tartaric acid


(2R,3R)-2,3-dihydroxybutanedioic acid; (2R,3R)-2,3-dihydroxysuccinic acid; (+)-tartaric acid; (2R,3R)-(+)-tartaric acid; (R,R)-tartaric acid; L(+)-tartaric acid; L-(+)-tartaric acid; L-tartaric acid; d-tartaric acid
Links:📏 NIST, 📖 PubMed
CAS RN:[87-69-4]
Formula:C4H6O6; 150.09 g/mol
InChiKey:FEWJPZIEWOKRBE-JCYAYHJZSA-N
SMILES:O[C@H]([C@@H](O)C(O)=O)C(O)=O
Molecular structure of (R,R)-tartaric acid
Density:1.790 g/mL
Molar volume:83.8 mL/mol
Melting point:170 °C
1g dissolves in:
0.72g water;    1.37g methanol;    3.62g ethanol;    9.22g propanol;    28.57g pentanol;    163.93g diethyl ether;    5,376.34g tetrachloromethane;    11,627.91g benzene;    20,000.00g trichloroethene

Isomers

(R,R)-tartaric acid
Molecular structure of (R,R)-tartaric acid
(S,S)-tartaric acid
Molecular structure of (S,S)-tartaric acid
meso-tartaric acid
Molecular structure of meso-tartaric acid
rac-tartaric acid
Molecular structure of rac-tartaric acid