3-nitrobenzoic acid


3-nitrobenzoic acid, m-nitrobenzoic acid
Links:⚗️ ChemSynthesis, 📖 PubMed
CAS:[121-92-6]
Formula:C7H5NO4; 167.12 g/mol
InChiKey:AFPHTEQTJZKQAQ-UHFFFAOYSA-N
SMILES:OC(=O)c1cccc(c1)[N+]([O-])=O
Molecular structure of 3-nitrobenzoic acid
Density:1.490 g/mL
Molar volume:112.2 mL/mol
Dipole moment:4.03 D
Melting point:141 °C
Log10 partition octanol / water:1.83
1g dissolvs in:
0.75g methanol;    1.11g ethanol;    1.12g ethanol;    1.67g methanol;    1.90g 2-propanone;    2.08g propanol;    2.83g diethyl ether;    31.65g trichloromethane;    111.11g benzene;    293.26g water;    1,250.00g carbon disulfide

Isomers

(E)-3-(5-nitro-2-furanyl)-2-propenal
Molecular structure of (E)-3-(5-nitro-2-furanyl)-2-propenal
1,2-methylenedioxy-4-nitrobenzene
Molecular structure of 1,2-methylenedioxy-4-nitrobenzene
2,3-pyridinedicarboxylic acid
Molecular structure of 2,3-pyridinedicarboxylic acid
2,6-pyridinedicarboxylic acid
Molecular structure of 2,6-pyridinedicarboxylic acid
2-hydroxy-3-nitrobenzaldehyde
Molecular structure of 2-hydroxy-3-nitrobenzaldehyde
2-hydroxy-4-nitrobenzaldehyde
Molecular structure of 2-hydroxy-4-nitrobenzaldehyde
2-hydroxy-5-nitrobenzaldehyde
Molecular structure of 2-hydroxy-5-nitrobenzaldehyde
2-nitrobenzoic acid
Molecular structure of 2-nitrobenzoic acid
3,5-pyridinedicarboxylic acid
Molecular structure of 3,5-pyridinedicarboxylic acid
3-hydroxy-4-nitrobenzaldehyde
Molecular structure of 3-hydroxy-4-nitrobenzaldehyde
3-nitrobenzoic acid
Molecular structure of 3-nitrobenzoic acid
4-hydroxy-3-nitrobenzaldehyde
Molecular structure of 4-hydroxy-3-nitrobenzaldehyde
4-nitrobenzoic acid
Molecular structure of 4-nitrobenzoic acid
4-nitrophenyl formate
Molecular structure of 4-nitrophenyl formate
5-hydroxy-2-nitrobenzaldehyde
Molecular structure of 5-hydroxy-2-nitrobenzaldehyde
pyridine-2,4-dicarboxylic acid
Molecular structure of pyridine-2,4-dicarboxylic acid
pyridine-2,5-dicarboxylic acid
Molecular structure of pyridine-2,5-dicarboxylic acid
pyridine-3,4-dicarboxylic acid
Molecular structure of pyridine-3,4-dicarboxylic acid