atropine


atropine; (RS)-(8-methyl-8-azabicyclo[3.2.1]oct-3-yl) 3-hydroxy-2-phenylpropanoate
Links:🌍 Wikipedia, 📏 NIST,
📖Houben-Weyl, 2. Band (Atropin); p. 475, 528
MeSH:Adjuvants, Anesthesia; Anti-Asthmatic Agents; Autonomic Agents; Bronchodilator Agents; Central Nervous System Agents; Cholinergic Agents; Cholinergic Antagonists; Muscarinic Antagonists; Neurotransmitter Agents
CAS:[51-55-8]
Formula:C17H23NO3; 289.37 g/mol
InChiKey:RKUNBYITZUJHSG-UHFFFAOYSA-N
SMILES:CN1C2CCC1CC(C2)OC(=O)C(CO)c3ccccc3
Molecular structure of atropine
Melting point:118 °C
Log10 partition octanol / water:1.83
1g dissolves in:
1.46g ethanol;    1.49g diethylamine;    1.56g trichloromethane;    2.94g aniline;    12.50g pyridine;    16.61g diethyl ether;    33.33g 1,2,3-propanetriol;    88.03g tetrachloromethane;    450.45g water

Isomers

atropine
Molecular structure of atropine
hyoscyamine
Molecular structure of hyoscyamine