cinchonidine


(-)-cinchonidine, α-quinidine, cinchonidine
Links:🌍 Wikipedia, 📖 PubMed
CAS:[485-71-2]
Formula:C19H22N2O; 294.40 g/mol
InChiKey:KMPWYEUPVWOPIM-UHFFFAOYSA-N
SMILES:OC(C1CC2CCN1CC2C=C)c3ccnc4ccccc34
Molecular structure of cinchonidine
Melting point:204 °C
Log10 partition octanol / water:2.82
1g dissolvs in:
5.26g trichloromethane;    10.75g trichloromethane;    12.85g pyridine;    13.53g methanol;    20.00g ethanol;    333.00g ethyl acetate;    473.93g diethyl ether;    787.40g benzene;    1,010.10g benzene;    1,968.50g tetrachloromethane;    2,105.26g hexane;    3,921.57g water;    4,761.90g water

Isomers

1-pentyl-2-phenyl-1,2,3,4-tetrahydro-4-oxoquinazoline
Molecular structure of 1-pentyl-2-phenyl-1,2,3,4-tetrahydro-4-oxoquinazoline
cinchonidine
Molecular structure of cinchonidine
cinchonine
Molecular structure of cinchonine
cinchotoxine
Molecular structure of cinchotoxine
noxiptilin
Molecular structure of noxiptilin