cocaine hydrochloride


cocaine hydrochloride; methyl 3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate hydrochloride
Links:🕷 ChemSpider, 📖 PubMed
CAS:[53-21-4]
Formula:C17H22ClNO4; 339.82 g/mol
InChiKey:PIQVDUKEQYOJNR-UHFFFAOYSA-N
SMILES:[H+].[Cl-].COC(=O)C1C(CC2CCC1N2C)OC(=O)c3ccccc3
Molecular structure of cocaine hydrochloride
Melting point:98 °C
1g dissolves in:
0.40g water;    2.63g ethanol;    4.00g 1,2,3-propanetriol;    18.52g trichloromethane