2,6,8-trimethyl-4-nonanone


2,6,8-trimethyl-4-nonanone
CAS:[123-18-2]
Formula:C12H24O; 184.32 g/mol
InChiKey:GFWVDQCGGDBTBS-UHFFFAOYSA-N
SMILES:CC(C)CC(C)CC(=O)CC(C)C
Molecular structure of 2,6,8-trimethyl-4-nonanone
Immiscible with:
(R,S)-2,3-butanediol,    1,2,3-propanetriol,    1,2-propanediol,    1,3-butanediol,    1,3-propanediol,    ethanediol,    sulfuric acid,    triethylene glycol,    triethylenetetramine
Miscible with:
(E)-3-phenyl-2-propenal,    1,2-diacetoxyethane,    1-heptadecanol,    1-tetradecanol,    2,6-dimethyl-4-heptanone,    2-(2-butoxyethoxy)ethanol,    2-(2-ethoxyethoxy)ethanol,    2-(2-methoxyethoxy)ethanol,    2-bromoethyl acetate,    2-butoxyethanol,    2-chloroethanol,    2-ethoxyaniline,    2-ethoxyethanol,    2-ethylbutanoic acid,    2-methoxyethanol,    2-phenoxyethanol,    3,6,9-trioxaundecane,    3-chloropropanol,    3-heptanol,    3-methyl-2-butanone,    3-methylbutyl acetate,    4-methylpentanoic acid,    4-oxa-2,6-heptandiol,    N,N-diethylformamide,    N,N-dipropylaniline,    a-methylbenzyldimethylamine,    benzene,    dibenzyl ether,    dibutyl carbonate,    dibutyl hydrogen phosphite,    diethyl ether,    diethylene glycol dibutyl ether,    dihexyl ether,    diisopropylamine,    dipentylamine,    ethanol,    ethyl benzoate,    ethyl chloroacetate,    ethyl phenylacetate,    heptyl acetate,    trans-ethyl cinnamate,    tributyl phosphate,    trichloromethane,    triethyl phosphate

Isomers

cyclododecanol
Molecular structure of cyclododecanol
2,2-dimethyl-5,5-diethylcyclohexanol
Molecular structure of 2,2-dimethyl-5,5-diethylcyclohexanol
dodecanal
Molecular structure of dodecanal
2-dodecanone
Molecular structure of 2-dodecanone
4-dodecanone
Molecular structure of 4-dodecanone
5-dodecanone
Molecular structure of 5-dodecanone
6-dodecanone
Molecular structure of 6-dodecanone
1,2-epoxydodecane
Molecular structure of 1,2-epoxydodecane
1-ethenoxydecane
Molecular structure of 1-ethenoxydecane
(1S,2R,4R)-2-ethoxy-1-isopropyl-4-methylcyclohexane
Molecular structure of (1S,2R,4R)-2-ethoxy-1-isopropyl-4-methylcyclohexane
2-methylundecanal
Molecular structure of 2-methylundecanal
2,6,8-trimethyl-4-nonanone
Molecular structure of 2,6,8-trimethyl-4-nonanone