N,N-dipropylaniline


di-N-propylaniline; N,N-dipropylaniline
Links:📏 NIST
CAS:[2217-07-4]
Formula:C12H19N; 177.29 g/mol
InChiKey:MMFBQHXDINNBMW-UHFFFAOYSA-N
SMILES:c1ccc(cc1)N(CCC)CCC
Molecular structure of N,N-dipropylaniline
Density:0.918 g/mL
Molar volume:193.2 mL/mol
Refractive index:1.529
Molecular refractive power:59.56 mL/mol
Boiling point:242 °C
Surface tension:32.79 dyn/cm
Immiscible with:
(+-)-3-chloro-1,2-propanediol,    (R,S)-2,3-butanediol,    1,2,3-propanetriol,    1,2-propanediol,    1,3-butanediol,    1,3-propanediol,    2-(2-aminoethylamino)ethanol,    4-hydroxy-4-methylpentan-2-one,    ethanediol,    formamide,    triethanolamine,    triethylene glycol
Miscible with:
(E)-3-phenyl-2-propenal,    1,2-diacetoxyethane,    1,2-diethoxyethane,    1-heptadecanol,    1-tetradecanol,    2,4-pentanedione,    2,6,8-trimethyl-4-nonanone,    2,6-dimethyl-4-heptanone,    2-(2-butoxyethoxy)ethanol,    2-(2-ethoxyethoxy)ethanol,    2-(2-methoxyethoxy)ethanol,    2-bromoethyl acetate,    2-butoxyethanol,    2-chloroethanol,    2-ethoxyaniline,    2-ethoxyethanol,    2-ethylbutanoic acid,    2-ethylhexanol,    2-methoxyethanol,    2-phenoxyethanol,    2-propanone,    3,6,9-trioxaundecane,    3-chloropropanol,    3-heptanol,    3-methyl-1-butanol,    3-methyl-2-butanone,    3-methylbutyl acetate,    4-methyl-2-pentanone,    4-methylpentanoic acid,    4-oxa-2,6-heptandiol,    N,N-diethylformamide,    N,N-dimethylaniline,    N-(2-aminoethyl)ethane-1,2-diamine,    a-methylbenzyldimethylamine,    aniline,    benzene,    benzyl alcohol,    butanol,    butyl acetate,    dibenzyl ether,    dibutyl carbonate,    dibutyl hydrogen phosphite,    diethyl ether,    diethylene glycol dibutyl ether,    dihexyl ether,    diisopropylamine,    dipentylamine,    ethanol,    ethyl benzoate,    ethyl chloroacetate,    ethyl phenylacetate,    furfuryl alcohol,    heptyl acetate,    pyridine,    tetrachloromethane,    tetraethylene glycol dibutyl ether,    trans-ethyl cinnamate,    tributyl phosphate,    trichloromethane,    triethyl phosphate,    triethylenetetramine

Isomers

N-tert-butyl-3,5-dimethylaniline
Molecular structure of N-tert-butyl-3,5-dimethylaniline
4-tert-butyl-N,N-dimethylaniline
Molecular structure of 4-tert-butyl-N,N-dimethylaniline
N,N-diisopropylaniline
Molecular structure of N,N-diisopropylaniline
2,6-diisopropylaniline
Molecular structure of 2,6-diisopropylaniline
N,N-dipropylaniline
Molecular structure of N,N-dipropylaniline
2-heptylpyridine
Molecular structure of 2-heptylpyridine
3-heptylpyridine
Molecular structure of 3-heptylpyridine
4-heptylpyridine
Molecular structure of 4-heptylpyridine
N-hexylaniline
Molecular structure of N-hexylaniline
4-hexylaniline
Molecular structure of 4-hexylaniline
isopropylamphetamine
Molecular structure of isopropylamphetamine
1-phenyl-2-amino-3,3-dimethylbutane
Molecular structure of 1-phenyl-2-amino-3,3-dimethylbutane
1-phenyl-2-aminohexane
Molecular structure of 1-phenyl-2-aminohexane
1-phenyl-2-amino-4-methylpentane
Molecular structure of 1-phenyl-2-amino-4-methylpentane
4-(1-propylbutyl)pyridine
Molecular structure of 4-(1-propylbutyl)pyridine
1-(3,4,5-trimethylphenyl)-2-aminopropane
Molecular structure of 1-(3,4,5-trimethylphenyl)-2-aminopropane