1,2-dinitrobenzene


1,2-dinitrobenzene, o-dinitrobenzene
Links:⚗️ ChemSynthesis, 📖 PubMed
CAS:[528-29-0]
Formula:C6H4N2O4; 168.11 g/mol
InChiKey:IZUKQUVSCNEFMJ-UHFFFAOYSA-N
SMILES:[O-][N+](=O)c1ccccc1[N+]([O-])=O
Molecular structure of 1,2-dinitrobenzene
Density:1.565 g/mL
Molar volume:107.4 mL/mol
Dipole moment:6.10 D
Melting point:118 °C
Boiling point:319 °C
Log10 partition octanol / water:1.69
1g dissolvs in:
0.38g pyridine;    3.69g trichloromethane;    7.72g ethyl acetate;    17.67g benzene;    27.62g toluene;    30.30g methanol;    52.63g ethanol;    91.74g propanol;    423.73g carbon disulfide;    476.19g water;    699.30g tetrachloromethane;    7,142.86g water

Isomers

1,2-dinitrobenzene
Molecular structure of 1,2-dinitrobenzene
1,3-dinitrobenzene
Molecular structure of 1,3-dinitrobenzene
1,4-dinitrobenzene
Molecular structure of 1,4-dinitrobenzene
2,3-pyrazinedicarboxylic acid
Molecular structure of 2,3-pyrazinedicarboxylic acid
2,4-dinitrosobenzene-1,3-diol
Molecular structure of 2,4-dinitrosobenzene-1,3-diol
6-nitropyridine-2-carboxylic acid
Molecular structure of 6-nitropyridine-2-carboxylic acid