1,3-dinitrobenzene


1,3-dinitrobenzene, DNB, m-dinitrobenzene
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS:[99-65-0]
Formula:C6H4N2O4; 168.11 g/mol
InChiKey:WDCYWAQPCXBPJA-UHFFFAOYSA-N
SMILES:[O-][N+](=O)c1cccc(c1)[N+]([O-])=O
Molecular structure of 1,3-dinitrobenzene
Density:1.565 g/mL
Molar volume:107.4 mL/mol
Dielectric constant:2.80
Dipole moment:3.87 D
Melting point:91 °C
Boiling point:303 °C
Log10 partition octanol / water:1.49
1g dissolvs in:
0.25g pyridine;    2.53g benzene;    2.76g ethyl acetate;    2.86g benzene;    3.03g trichloromethane;    3.09g trichloromethane;    3.26g toluene;    4.63g acetic acid;    6.45g propanoic acid;    9.52g formic acid;    11.24g butanoic acid;    14.81g methanol;    17.70g methanol;    28.57g ethanol;    34.25g ethanol;    41.67g propanol;    46.73g water;    50.00g propanol;    74.07g carbon disulfide;    84.75g tetrachloromethane;    1,904.76g water

Isomers

1,2-dinitrobenzene
Molecular structure of 1,2-dinitrobenzene
1,3-dinitrobenzene
Molecular structure of 1,3-dinitrobenzene
1,4-dinitrobenzene
Molecular structure of 1,4-dinitrobenzene
2,3-pyrazinedicarboxylic acid
Molecular structure of 2,3-pyrazinedicarboxylic acid
2,4-dinitrosobenzene-1,3-diol
Molecular structure of 2,4-dinitrosobenzene-1,3-diol
6-nitropyridine-2-carboxylic acid
Molecular structure of 6-nitropyridine-2-carboxylic acid