2,4,6-trinitrophenol


2,4,6-trinitrophenol, picric acid
Links:📖 PubMed
MeSH:Enzyme Inhibitors; Indicators and Reagents
CAS:[88-89-1]
Formula:C6H3N3O7; 229.11 g/mol
InChiKey:OXNIZHLAWKMVMX-UHFFFAOYSA-N
SMILES:Oc1c(cc(cc1[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O
Molecular structure of 2,4,6-trinitrophenol
Density:1.763 g/mL
Molar volume:130.0 mL/mol
Dipole moment:1.34 D
Melting point:122 °C
Log10 partition octanol / water:1.82
1g dissolvs in:
4.44g methanol;    8.33g toluene;    9.23g formic acid;    10.46g benzene;    11.95g ethanol;    20.00g diethyl ether;    26.25g propanol;    56.98g pentanol;    68.97g water;    90.09g water

Isomers

2,3,6-trinitrophenol
Molecular structure of 2,3,6-trinitrophenol
2,4,5-trinitrophenol
Molecular structure of 2,4,5-trinitrophenol
2,4,6-trinitrophenol
Molecular structure of 2,4,6-trinitrophenol