3-nitroaniline


3-nitroaniline, 3-nitrobenzenamine, m-nitroaniline
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS:[99-09-2]
Formula:C6H6N2O2; 138.13 g/mol
InChiKey:XJCVRTZCHMZPBD-UHFFFAOYSA-N
SMILES:Nc1cccc(c1)[N+]([O-])=O
Molecular structure of 3-nitroaniline
Density:0.900 g/mL
Molar volume:153.5 mL/mol
Dipole moment:4.72 D
Melting point:11 °C
Boiling point:306 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Critical pressure:4.4 atm
Log10 partition octanol / water:1.43
1g dissolvs in:
9.04g methanol;    11.75g 3-methyl-1-butanol;    12.42g ethanol;    12.67g diethyl ether;    17.70g propanol;    33.22g trichloromethane;    37.88g 2-methyl-1-propanol;    40.82g benzene;    58.48g toluene;    86.96g cumene;    303.03g carbon dioxide;    476.19g tetrachloromethane;    598.80g water

Isomers

(E)-4-imidazoleacrylic acid
Molecular structure of (E)-4-imidazoleacrylic acid
1,1-dicyanoethyl acetate
Molecular structure of 1,1-dicyanoethyl acetate
1,2-benzoquinone dioxime
Molecular structure of 1,2-benzoquinone dioxime
1,4-benzoquinone dioxime
Molecular structure of 1,4-benzoquinone dioxime
2-aminopyridine-3-carboxylic acid
Molecular structure of 2-aminopyridine-3-carboxylic acid
2-aminopyridine-4-carboxylic acid
Molecular structure of 2-aminopyridine-4-carboxylic acid
2-methylpyrazine-5-carboxylic acid
Molecular structure of 2-methylpyrazine-5-carboxylic acid
2-nitroaniline
Molecular structure of 2-nitroaniline
3-aminopyridine-4-carboxylic acid
Molecular structure of 3-aminopyridine-4-carboxylic acid
3-hydroxypyridine-2-carboxamide
Molecular structure of 3-hydroxypyridine-2-carboxamide
3-methyl-5-nitropyridine
Molecular structure of 3-methyl-5-nitropyridine
3-nitroaniline
Molecular structure of 3-nitroaniline
4-aminonicotinic acid
Molecular structure of 4-aminonicotinic acid
4-methyl-3-nitropyridine
Molecular structure of 4-methyl-3-nitropyridine
4-nitroaniline
Molecular structure of 4-nitroaniline
5-aminopyridine-2-carboxylic acid
Molecular structure of 5-aminopyridine-2-carboxylic acid
5-methyl-2-pyrazinecarboxylic acid
Molecular structure of 5-methyl-2-pyrazinecarboxylic acid
5-vinyluracil
Molecular structure of 5-vinyluracil
6-amino-3-pyridinecarboxylic acid
Molecular structure of 6-amino-3-pyridinecarboxylic acid
6-aminopyridine-2-carboxylic acid
Molecular structure of 6-aminopyridine-2-carboxylic acid
methyl pyrazine-2-carboxylate
Molecular structure of methyl pyrazine-2-carboxylate
methyl pyridazine-4-carboxylate
Molecular structure of methyl pyridazine-4-carboxylate
N-phenylnitramide
Molecular structure of N-phenylnitramide
urocanic acid
Molecular structure of urocanic acid