4-nitroaniline


4-nitroaniline, 4-nitrobenzenamine, p-nitroaniline
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS:[100-01-6]
Formula:C6H6N2O2; 138.13 g/mol
InChiKey:TYMLOMAKGOJONV-UHFFFAOYSA-N
SMILES:Nc1ccc(cc1)[N+]([O-])=O
Molecular structure of 4-nitroaniline
Density:1.437 g/mL
Molar volume:96.1 mL/mol
Dielectric constant:56.30
Dipole moment:6.91 D
Melting point:148 °C
Boiling point:332 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Critical pressure:4.4 atm
Log10 partition octanol / water:2.10
1g dissolvs in:
10.43g methanol;    15.90g 3-methyl-1-butanol;    16.39g diethyl ether;    17.12g ethanol;    22.99g propanol;    43.29g trichloromethane;    50.51g benzene;    52.36g 2-methyl-1-propanol;    76.34g toluene;    111.11g cumene;    384.62g carbon dioxide;    588.24g tetrachloromethane;    1,250.00g water

Isomers

(E)-4-imidazoleacrylic acid
Molecular structure of (E)-4-imidazoleacrylic acid
1,1-dicyanoethyl acetate
Molecular structure of 1,1-dicyanoethyl acetate
1,2-benzoquinone dioxime
Molecular structure of 1,2-benzoquinone dioxime
1,4-benzoquinone dioxime
Molecular structure of 1,4-benzoquinone dioxime
2-aminopyridine-3-carboxylic acid
Molecular structure of 2-aminopyridine-3-carboxylic acid
2-aminopyridine-4-carboxylic acid
Molecular structure of 2-aminopyridine-4-carboxylic acid
2-methylpyrazine-5-carboxylic acid
Molecular structure of 2-methylpyrazine-5-carboxylic acid
2-nitroaniline
Molecular structure of 2-nitroaniline
3-aminopyridine-4-carboxylic acid
Molecular structure of 3-aminopyridine-4-carboxylic acid
3-hydroxypyridine-2-carboxamide
Molecular structure of 3-hydroxypyridine-2-carboxamide
3-methyl-5-nitropyridine
Molecular structure of 3-methyl-5-nitropyridine
3-nitroaniline
Molecular structure of 3-nitroaniline
4-aminonicotinic acid
Molecular structure of 4-aminonicotinic acid
4-methyl-3-nitropyridine
Molecular structure of 4-methyl-3-nitropyridine
4-nitroaniline
Molecular structure of 4-nitroaniline
5-aminopyridine-2-carboxylic acid
Molecular structure of 5-aminopyridine-2-carboxylic acid
5-methyl-2-pyrazinecarboxylic acid
Molecular structure of 5-methyl-2-pyrazinecarboxylic acid
5-vinyluracil
Molecular structure of 5-vinyluracil
6-amino-3-pyridinecarboxylic acid
Molecular structure of 6-amino-3-pyridinecarboxylic acid
6-aminopyridine-2-carboxylic acid
Molecular structure of 6-aminopyridine-2-carboxylic acid
methyl pyrazine-2-carboxylate
Molecular structure of methyl pyrazine-2-carboxylate
methyl pyridazine-4-carboxylate
Molecular structure of methyl pyridazine-4-carboxylate
N-phenylnitramide
Molecular structure of N-phenylnitramide
urocanic acid
Molecular structure of urocanic acid