4-nitrobenzyl chloride


1-chloromethyl-4-nitrobenzene, 4-nitrobenzyl chloride, p-nitrobenzyl chloride
Links:📏 NIST, 📖 PubMed
CAS:[100-14-1]
Formula:C7H6ClNO2; 171.58 g/mol
InChiKey:KGCNHWXDPDPSBV-UHFFFAOYSA-N
SMILES:[O-][N+](=O)c1ccc(CCl)cc1
Molecular structure of 4-nitrobenzyl chloride
Dipole moment:3.66 D
Melting point:72 °C
Log10 partition octanol / water:2.45
1g dissolvs in:
0.93g 2-propanone;    1.04g acetonitrile;    1.45g nitromethane;    1.58g acetophenone;    1.68g benzene;    1.75g nitrobenzene;    1.75g ethyl acetate;    1.95g ethyl nitrite;    1.96g 2-nitrotoluene;    2.10g trichloromethane;    2.21g benzyl chloride;    2.31g ethyl benzoate;    3.13g bromobenzene;    3.28g 1-bromonaphthalene;    4.03g 2,4,6-trimethyl-1,3,5-trioxane;    4.33g diethyl ether;    4.65g butanol;    5.52g acetic acid;    8.62g 1-bromo-3-methylbutane;    11.27g methanol;    14.08g ethanol;    16.58g tetrachloromethane;    17.54g propanol;    20.49g pentanol;    77.52g hexane;    204.08g 2-methylbutane

Isomers

1-chloro-3-methyl-5-nitrobenzene
Molecular structure of 1-chloro-3-methyl-5-nitrobenzene
2-amino-3-chlorobenzoic acid
Molecular structure of 2-amino-3-chlorobenzoic acid
2-amino-4-chlorobenzoic acid
Molecular structure of 2-amino-4-chlorobenzoic acid
2-amino-5-chlorobenzoic acid
Molecular structure of 2-amino-5-chlorobenzoic acid
2-amino-6-chlorobenzoic acid
Molecular structure of 2-amino-6-chlorobenzoic acid
2-chloro-1-methyl-3-nitrobenzene
Molecular structure of 2-chloro-1-methyl-3-nitrobenzene
2-chloro-1-methyl-4-nitrobenzene
Molecular structure of 2-chloro-1-methyl-4-nitrobenzene
2-chloro-1-methyl-4-nitrobenzene
Molecular structure of 2-chloro-1-methyl-4-nitrobenzene
2-chloro-4-methyl-1-nitrobenzene
Molecular structure of 2-chloro-4-methyl-1-nitrobenzene
2-chloro-5-nitrotoluene
Molecular structure of 2-chloro-5-nitrotoluene
2-chloro-6-methylnicotinic acid
Molecular structure of 2-chloro-6-methylnicotinic acid
2-chloro-6-methylpyridine-3-carboxylic acid
Molecular structure of 2-chloro-6-methylpyridine-3-carboxylic acid
2-chloro-6-methylpyridine-4-carboxylic acid
Molecular structure of 2-chloro-6-methylpyridine-4-carboxylic acid
2-chloro-6-nitrotoluene
Molecular structure of 2-chloro-6-nitrotoluene
2-chloropyridine-4-acetic acid
Molecular structure of 2-chloropyridine-4-acetic acid
2-nitrobenzyl chloride
Molecular structure of 2-nitrobenzyl chloride
3-amino-2-chlorobenzoic acid
Molecular structure of 3-amino-2-chlorobenzoic acid
3-amino-4-chlorobenzoic acid
Molecular structure of 3-amino-4-chlorobenzoic acid
3-chloro-4-aminobenzoic acid
Molecular structure of 3-chloro-4-aminobenzoic acid
3-nitrobenzyl chloride
Molecular structure of 3-nitrobenzyl chloride
4-amino-2-chlorobenzoic acid
Molecular structure of 4-amino-2-chlorobenzoic acid
4-amino-3-chlorobenzoic acid
Molecular structure of 4-amino-3-chlorobenzoic acid
4-chloro-2-methyl-1-nitrobenzene
Molecular structure of 4-chloro-2-methyl-1-nitrobenzene
4-chloro-2-nitrotoluene
Molecular structure of 4-chloro-2-nitrotoluene
4-chloro-3-nitrotoluene
Molecular structure of 4-chloro-3-nitrotoluene
4-nitrobenzyl chloride
Molecular structure of 4-nitrobenzyl chloride
5-amino-2-chlorobenzoic acid
Molecular structure of 5-amino-2-chlorobenzoic acid
5-chloro-2-hydroxybenzamide
Molecular structure of 5-chloro-2-hydroxybenzamide
6-chloro-2-methoxypyridine-3-carboxaldehyde
Molecular structure of 6-chloro-2-methoxypyridine-3-carboxaldehyde
6-chloro-3-pyridineacetic acid
Molecular structure of 6-chloro-3-pyridineacetic acid
methyl 2-chloropyridine-3-carboxylate
Molecular structure of methyl 2-chloropyridine-3-carboxylate
methyl 2-chloropyridine-4-carboxylate
Molecular structure of methyl 2-chloropyridine-4-carboxylate
methyl 6-chloropyridine-3-carboxylate
Molecular structure of methyl 6-chloropyridine-3-carboxylate