camphoric acid


(1R,3S)-(+)-camphoric acid; (1R,3S)-camphoric acid; camphoric acid; δ-camphoric acid; (1R,3S)-1,2,2-trimethylcyclopentane-1,3-dicarboxylic acid
Links:📏 NIST, 🕷 ChemSpider, 📖 PubMed,
📖Org. Chem., v. Richter, 1. Vol (Camphoric Acid); p. 493, 495
CAS:[560-09-8]
Formula:C10H16O4; 200.23 g/mol
InChiKey:LSPHULWDVZXLIL-UHFFFAOYSA-N
SMILES:CC1(C)C(CCC1(C)C(O)=O)C(O)=O
Molecular structure of camphoric acid
Melting point:187 °C
Log10 partition octanol / water:0.01
1g dissolves in:
0.76g methanol;    0.89g ethanol;    1.00g ethanol;    1.09g diethyl ether;    1.64g propanol;    1.85g 2-methyl-1-propanol;    2.00g 3-methyl-1-butanol;    11.52g formic acid;    125.00g water;    125.00g water;    200.00g nitrobenzene;    507.61g cumene;    653.59g trichloromethane;    666.67g toluene;    5,000.00g carbon disulfide;    12,500.00g benzene;    14,285.71g hexane

Isomers

(-)-camphoric acid
Molecular structure of (-)-camphoric acid
camphoric acid
Molecular structure of camphoric acid
l-camphoric acid
Molecular structure of l-camphoric acid
cyclohexane-1,1-diacetic acid
Molecular structure of cyclohexane-1,1-diacetic acid
cis-cyclohexane-1,2-diacetic acid
Molecular structure of cis-cyclohexane-1,2-diacetic acid
trans-cyclohexane-1,2-diacetic acid
Molecular structure of trans-cyclohexane-1,2-diacetic acid
1,4-cyclohexanedione bisethylene ketal
Molecular structure of 1,4-cyclohexanedione bisethylene ketal
diethyl cyclobutane-1,1-dicarboxylate
Molecular structure of diethyl cyclobutane-1,1-dicarboxylate
diethyl isopropylidenepropanedioate
Molecular structure of diethyl isopropylidenepropanedioate
diethyl (E)-3-methyl-2-pentendioate
Molecular structure of diethyl (E)-3-methyl-2-pentendioate
diethyl (Z)-3-methyl-2-pentendioate
Molecular structure of diethyl (Z)-3-methyl-2-pentendioate
diethyl 2-prop-2-enylpropanedioate
Molecular structure of diethyl 2-prop-2-enylpropanedioate
diisopropyl fumarate
Molecular structure of diisopropyl fumarate
dimethyl cyclohexane-1,1-dicarboxylate
Molecular structure of dimethyl cyclohexane-1,1-dicarboxylate
dimethyl trans-cyclohexane-1,4-dicarboxylate
Molecular structure of dimethyl trans-cyclohexane-1,4-dicarboxylate
dipropyl (2E)-2-butenedioate
Molecular structure of dipropyl (2E)-2-butenedioate
dipropyl (2Z)-2-butenedioate
Molecular structure of dipropyl (2Z)-2-butenedioate
ethyl 4-acetyl-5-oxohexanoate
Molecular structure of ethyl 4-acetyl-5-oxohexanoate
ethyl (R)-cis-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propenoate
Molecular structure of ethyl (R)-cis-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propenoate
ethyl (R)-(-)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-trans-2-propenoate
Molecular structure of ethyl (R)-(-)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-trans-2-propenoate
ethyl trans-(S)-(+)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-propenoate
Molecular structure of ethyl trans-(S)-(+)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-propenoate
ethyl 6,6-dimethyl-2-oxooxane-3-carboxylate
Molecular structure of ethyl 6,6-dimethyl-2-oxooxane-3-carboxylate
(5-ethyl-1,3-dioxan-5-yl)methyl prop-2-enoate
Molecular structure of (5-ethyl-1,3-dioxan-5-yl)methyl prop-2-enoate
ethyl 2-ethoxymethylene-3-oxopentanoate
Molecular structure of ethyl 2-ethoxymethylene-3-oxopentanoate
ethyl trimethylacetopyruvate
Molecular structure of ethyl trimethylacetopyruvate
3-methylcyclopentane-1,1-diacetic acid
Molecular structure of 3-methylcyclopentane-1,1-diacetic acid