dibenzyl ether


benzyl ether; benzylic ether; dibenzyl ether; phenylmethoxymethylbenzene; tribenoside impurity D
Links:📏 NIST, 🕷 ChemSpider, 📖 PubMed,
📖Houben-Weyl, 2. Band (Dibenzyl├Ąther); p. 246, 455
CAS:[103-50-4]
Formula:C14H14O; 198.26 g/mol
InChiKey:MHDVGSVTJDSBDK-UHFFFAOYSA-N
SMILES:O(Cc1ccccc1)CC2=CC=CC=C2
Molecular structure of dibenzyl ether
Density:1.044 g/mL
Molar volume:189.9 mL/mol
Refractive index:1.561
Molecular refractive power:61.50 mL/mol
Dielectric constant:3.86
Dipole moment:1.39 D
Melting point:4 °C
Boiling point:297 °C
Surface tension:39.80 dyn/cm
Log10 partition octanol / water:3.31
Snyder X:Xe: 0.3    Xd: 0.3    Xn: 0.4
Dimroth ET:36.3
Hansen solubility parameter:δd: 8.5 (cal/ml)^0.5   δp: 1.8 (cal/ml)^0.5   δh: 3.6 (cal/ml)^0.5
Immiscible with:
(R,S)-2,3-butanediol,    1,2,3-propanetriol,    1,2-propanediol,    1,3-butanediol,    1,3-propanediol,    ethanediol,    triethylene glycol
Miscible with:
(+-)-3-chloro-1,2-propanediol,    (E)-3-phenyl-2-propenal,    1,2-diacetoxyethane,    1-heptadecanol,    1-tetradecanol,    2,6,8-trimethyl-4-nonanone,    2,6-dimethyl-4-heptanone,    2-(2-butoxyethoxy)ethanol,    2-(2-ethoxyethoxy)ethanol,    2-(2-methoxyethoxy)ethanol,    2-bromoethyl acetate,    2-butoxyethanol,    2-chloroethanol,    2-ethoxyaniline,    2-ethoxyethanol,    2-ethylbutanoic acid,    2-methoxyethanol,    2-phenoxyethanol,    2-propanone,    3,6,9-trioxaundecane,    3-chloropropanol,    3-heptanol,    3-methyl-2-butanone,    3-methylbutyl acetate,    4-methylpentanoic acid,    4-oxa-2,6-heptandiol,    N,N-diethylformamide,    N,N-dipropylaniline,    N-(2-aminoethyl)ethane-1,2-diamine,    a-methylbenzyldimethylamine,    benzene,    dibenzyl ether,    dibutyl carbonate,    dibutyl hydrogen phosphite,    diethyl ether,    diethylene glycol dibutyl ether,    dihexyl ether,    diisopropylamine,    dipentylamine,    ethanol,    ethyl benzoate,    ethyl chloroacetate,    ethyl phenylacetate,    heptyl acetate,    hexanenitrile,    trans-ethyl cinnamate,    tributyl phosphate,    trichloromethane,    triethyl phosphate,    triethylenetetramine

Isomers

1-(4-biphenylyl)ethanol
Molecular structure of 1-(4-biphenylyl)ethanol
dibenzyl ether
Molecular structure of dibenzyl ether
1,3-dimethyl-2-phenoxybenzene
Molecular structure of 1,3-dimethyl-2-phenoxybenzene
1,1-diphenylethanol
Molecular structure of 1,1-diphenylethanol
1,2-diphenylethanol
Molecular structure of 1,2-diphenylethanol
2,2-diphenylethanol
Molecular structure of 2,2-diphenylethanol
1-ethoxy-3-phenylbenzene
Molecular structure of 1-ethoxy-3-phenylbenzene
1-ethyl-4-acetylnaphthalene
Molecular structure of 1-ethyl-4-acetylnaphthalene
2-methylbenzhydrol
Molecular structure of 2-methylbenzhydrol
4-methylbenzhydrol
Molecular structure of 4-methylbenzhydrol
1-methyl-2-(2-methylphenoxy)benzene
Molecular structure of 1-methyl-2-(2-methylphenoxy)benzene
1-methyl-3-(4-methylphenoxy)benzene
Molecular structure of 1-methyl-3-(4-methylphenoxy)benzene
1-methyl-4-(4-methylphenoxy)benzene
Molecular structure of 1-methyl-4-(4-methylphenoxy)benzene
2-methyl-1-naphthalen-2-ylpropan-1-one
Molecular structure of 2-methyl-1-naphthalen-2-ylpropan-1-one
5-methyl-2-phenylmethylphenol
Molecular structure of 5-methyl-2-phenylmethylphenol
(3-methylphenyl)-phenylmethanol
Molecular structure of (3-methylphenyl)-phenylmethanol
3-[(E)-2-phenylethenyl]cyclohex-2-en-1-one
Molecular structure of 3-[(E)-2-phenylethenyl]cyclohex-2-en-1-one
2-(2-phenylethyl)phenol
Molecular structure of 2-(2-phenylethyl)phenol
propyl 1-naphthyl ketone
Molecular structure of propyl 1-naphthyl ketone